Multiple choice

Which of the following is an unsaturated fatty acid having two carbon-carbon double bonds in its structure?

  1. Lauric acid

  2. Myristic acid

  3. Palmitic acid

  4. Oleic acid

  5. Linoleic acid

Reveal answer Fill a bubble to check yourself
E Correct answer
Explanation

Correct answer. Linoleic acid, CH3(CH2)4CH=CHCH2CH=CH(CH2)7COOH, is a polyunsaturated omega-6 fatty acid. It has two carbon-carbon double bonds in its structure.