Tag: ozone layer depletion and causes

Questions Related to ozone layer depletion and causes

Multiple choice zoology human influences on the environment carbon cycle ozone layer depletion and causes depletion of ozone layer

Substitute of chlorofluorocarbon is

  1. Hydrofluorocarbon

  2. Hydrochlorofluorocarbon

  3. Fluorocarbon

  4. Both A and B

Reveal answer Fill a bubble to check yourself
D Correct answer
Explanation
Chlorofluorocarbons (CFC) are the chemicals used as refrigerants. They cause ozone depletion as they release chloride radicals which on reacting with ozone causes its degradation.
The chlorofluorocarbons can be substituted by Hydrofluorocarbon (HFC) or Hydrochlorofluorocarbon (HCFC) for using as refrigerants and in air conditioners. Though HFCs and HCFCs also deplete ozone but to lesser extent than CFCs.
Hence, both options A and B are correct.
So, the correct answer is 'Both A and B'.
Multiple choice zoology human influences on the environment carbon cycle ozone layer depletion and causes depletion of ozone layer

Green house effect is the cumulative result of the influences of certain gases. Identify the gas which is not involved in this influence?

  1. Methane

  2. Carbon dioxide

  3. Chlorofluorocarbons

  4. Nitrogen

Reveal answer Fill a bubble to check yourself
D Correct answer
Explanation

Certain gases such as methane, carbon dioxide, chlorofluorocarbons are called greenhouse gases because they absorb and thus trap some of the radiation. The nitrogen is the second most abundant act found in the atmosphere after oxygen. These gases do not have the ability to intercept infrared radiation and hence they do not contribute to causing of the greenhouse effect. Methane, carbon dioxide and chlorofluorocarbons are potent greenhouse gases.

Hence, the correct answer is 'Nitrogen'.

Multiple choice zoology human influences on the environment carbon cycle ozone layer depletion and causes depletion of ozone layer

The two gases making highest relative contribution to the green house gases are

  1. $CH _4$ and $N _2O$
  2. CFCs and $N _2O$
  3. $CO _2$ and $NO _2$
  4. $CO _2$ and $CH _4$
Reveal answer Fill a bubble to check yourself
D Correct answer
Explanation
The gases responsible for green house effect are called green house gases which trap the radiations and don't let them reflect back from the earth's surface. The green house gases are Chlorofluorocarbons (CFC's), Carbon dioxide (CO2), Methane (CH4) and Nitrous Oxide (N2O). 
The approximate percentage of different greenhouse gases in the atmosphere is:
CFCs - 14%
CO2 - 60%
‎CH4 - 20%
N2O - 6%
Hence, CO2 and CH4 have highest relative contribution to green house gases.
So, the correct answer is 'CO2 and CH4'.
Multiple choice zoology human influences on the environment carbon cycle ozone layer depletion and causes depletion of ozone layer

At present, the concentration of atmospheric $CO 2$ is ________.

  1. $100$ ppm
  2. $240$ ppm
  3. $380$ ppm
  4. $520$ ppm
Reveal answer Fill a bubble to check yourself
C Correct answer
Explanation
CO2 is a major pollutant of air and a green house gas that contributes to global warming. Concentration of CO2 in the atmosphere is expressed in terms of parts per million or ppm. According to latest research by forecasting systems, CO2 concentration was found to be about 380 ppm which in recent years has increased upto 400 ppm.
So, the correct answer is '380 ppm'.
Multiple choice zoology human influences on the environment carbon cycle ozone layer depletion and causes depletion of ozone layer

Gases responsible for green house effect are

  1. $CO _2$
  2. CFC

  3. $N _2O$
  4. All the above

Reveal answer Fill a bubble to check yourself
D Correct answer
Explanation

A greenhouse gas is a gas in an atmosphere that absorbs and emits radiant energy within the thermal infrared range. This process is the fundamental cause of the greenhouse effect. The primary greenhouse gases in Earth's atmosphere are water vapour, carbon dioxide, methane, CFC's, nitrous oxide, and ozone.

So the correct answer is 'All the above'.

Multiple choice zoology human influences on the environment carbon cycle ozone layer depletion and causes depletion of ozone layer

One GHG contributes $6\%$ to total global warming, other contributes to $20\%$; they are.

  1. $NO _2$ and $CO _2$
  2. $N _2O$ and CFCs
  3. CFCs and methane

  4. $N _2O$ and methane
  5. $CO _2$ and CFCs
Reveal answer Fill a bubble to check yourself
D Correct answer
Explanation
The relative contribution of various greenhouse gases to total global warming are as follows:
Methane: 20%
CFCs(Chloro-fluoro-carbons): 14%
N$ _2$O: 6%
Carbon dioxide: 60%
So, the correct answer is 'Option D- N$ _2$O and methane'.
Multiple choice zoology human influences on the environment carbon cycle ozone layer depletion and causes depletion of ozone layer

Greenhouse gases are

  1. $CO _2$ and $CH _4$
  2. $N _2O$ and CFCs
  3. Ozone

  4. All of the above

Reveal answer Fill a bubble to check yourself
D Correct answer
Explanation

Carbon dioxide and methane are naturally occurring gases. Nitrous oxides are formed due to denitrification and combustion of the fossil fuels. CFCs are used as refrigerants and propellants. Ozone is formed as a secondary pollutant. All these are greenhouse gases because they show greenhouse effect by absorbing the the long-wavelength infra-red radiations coming from the earth's surface and preventing from leaving the atmosphere. This effect is responsible for maintaining the ambient temperature on the earth. Their  amounts have increased over the past years and this has adversely affected the global temperature by raiding it. This is called global warming and is responsible for climate change. 

Hence, the correct answer is 'All of the above'

Multiple choice zoology human influences on the environment carbon cycle ozone layer depletion and causes depletion of ozone layer

Which one of the following statements is not correct?

  1. The greenhouse gases trap out the heal in infra-red radiation

  2. Natural gas supplies five percent f global energy needs

  3. One molecule of CFC can trap as many as $10,000$ molecules of $CO _2$
  4. The atmospheric life time to $CFCl _3$ is estimated at $75$ years
Reveal answer Fill a bubble to check yourself
B Correct answer
Explanation

Natural gas actually supplies roughly 24 percent of global energy needs, making the statement that it supplies five percent incorrect. The other statements regarding greenhouse gases, CFC potency, and atmospheric lifetimes are factual.

Multiple choice zoology human influences on the environment carbon cycle ozone layer depletion and causes depletion of ozone layer

Green house gases are called as such because they.

  1. Prevent the escape of heat waves reradiated from the earth's surface

  2. Are produced in greenhouses

  3. Are used in warming plant growth chambers

  4. Help in maintaining atmospheric $O _2$ and $CO _2$ balance
Reveal answer Fill a bubble to check yourself
A Correct answer
Explanation

Greenhouse gases are named for their ability to mimic the effect of a greenhouse, where glass allows sunlight in but traps the heat reradiated from the surface.

Multiple choice zoology human influences on the environment carbon cycle ozone layer depletion and causes depletion of ozone layer

Choose the correct answer form the alternatives given.
The second biggest greenhouse gas emitter (after the USA) in the world is:

  1. Russia

  2. Germany

  3. China

  4. Japan

Reveal answer Fill a bubble to check yourself
C Correct answer
Explanation

China is currently the world's largest emitter of greenhouse gases, and historically, it has been the second-largest emitter after the USA for many years.