Environmental Studies · General Awareness

Greenhouse Gases and Atmosphere

1,328 Questions

Review important questions related to greenhouse gases, global warming, and atmospheric changes. The practice set focuses on identifying major pollutants and their environmental impact. These concepts are tested in the general awareness and environmental studies sections.

Greenhouse gas identificationGlobal warming processAtmospheric carbon dioxideMethane emissionsCement production emissions

Greenhouse Gases and Atmosphere Questions

Multiple choice zoology human influences on the environment carbon cycle ozone layer depletion and causes depletion of ozone layer

Which of the following contribute to green house effect?

  1. Methane

  2. Carbondioxide

  3. CFCs

  4. All of the above
Reveal answer Fill a bubble to check yourself
D Correct answer
Explanation

(The greenhouse effect is the natural process by which the atmosphere traps some of the Sun's energy,  warming the Earth enough to support life.  Most mainstream scientists believe a human-driven increase in "greenhouse gases" is increasing the effect artificially.
These gases include carbon dioxide, methane, nitrous oxide, water vapour, CFCs, ozone etc. Ozone in the stratosphere acts as a protective layer, but harmful if it is present in the troposphere).

So, the correct answer is All of the above'.

Multiple choice zoology human influences on the environment carbon cycle ozone layer depletion and causes depletion of ozone layer

Which one of the following is not a green house gas?

  1. $CO _2$
  2. $CH _4$
  3. $O _2$

  4. CFCs
Reveal answer Fill a bubble to check yourself
C Correct answer
Explanation

Greenhouse gases are called so because they are capable of absorbing the insolation from the sun and keeping it within the troposphere, thereby increasing the overall temperature of the earth, called global warming. Carbon dioxide, methane, nitrous oxide, ozone, Chlorofluorocarbons and sulphur hexafluoride are considered to be the potent greenhouse gases. Oxygen is not a greenhouse gas.

Hence, the correct answer is 'O$ _{2}$' 

Multiple choice zoology human influences on the environment carbon cycle ozone layer depletion and causes depletion of ozone layer

Green house gases include

  1. $CO _2, CHC, CH _4$ and $N _2O$
  2. $CO _2, O _2, N _2, NO _2$ and $NH _3$
  3. $CH _4, N _2. CO _2$ and $NH _3$
  4. $CFC, CO _2, NH _3$ and $N _2$
Reveal answer Fill a bubble to check yourself
A Correct answer
Explanation

A greenhouse gas absorb radiation and emit heat energy maintaining the Earth's temperature. However, when released in excess amounts, they cause global warming. Sources are volcanic eruptions, burning of fossil fuels, deforestation, vehicular exhausts, industrial emissions etc. contribute to the greenhouse gases. Carbon dioxide, Chlorinated hydrocarbon (CHC), Methane and oxides of nitrogen are considered to be the major greenhouse gases.

Hence, the correct answer is 'CO$ _{2}$, CHC, CH$ _{4}$ and N$ _{2}$O'

Multiple choice zoology human influences on the environment carbon cycle ozone layer depletion and causes depletion of ozone layer

Which is not a green house gas?

  1. Chlorofluorocarbon

  2. Methane

  3. Carbon dioxide

  4. Hydrogen
Reveal answer Fill a bubble to check yourself
D Correct answer
Explanation
Greenhouse gases cause greenhouse effect by trapping the infrared radiation trying to escape back to space. This process increases the earth’s temperature. Gases which contributes in greenhouse effect are carbon dioxide, methane, nitrous oxide, ozone, water vapour, Chlorofluorocarbons (CFCs) and, Hydrofluorocarbons (HCFCs and HFCs). Hydrogen is not a greenhouse gas.
Hence, the correct answer is ‘Hydrogen’.
Multiple choice zoology human influences on the environment carbon cycle ozone layer depletion and causes depletion of ozone layer

Green house effect is the cumulative result of the influences of certain gases. Identify the gas which is not involved in this influence?

  1. Methane

  2. Carbon dioxide

  3. Chlorofluorocarbons

  4. Nitrogen
Reveal answer Fill a bubble to check yourself
D Correct answer
Explanation

Certain gases such as methane, carbon dioxide, chlorofluorocarbons are called greenhouse gases because they absorb and thus trap some of the radiation. The nitrogen is the second most abundant act found in the atmosphere after oxygen. These gases do not have the ability to intercept infrared radiation and hence they do not contribute to causing of the greenhouse effect. Methane, carbon dioxide and chlorofluorocarbons are potent greenhouse gases.

Hence, the correct answer is 'Nitrogen'.

Multiple choice zoology human influences on the environment carbon cycle ozone layer depletion and causes depletion of ozone layer

The two gases making highest relative contribution to the green house gases are

  1. $CH _4$ and $N _2O$
  2. CFCs and $N _2O$
  3. $CO _2$ and $NO _2$
  4. $CO _2$ and $CH _4$
Reveal answer Fill a bubble to check yourself
D Correct answer
Explanation
The gases responsible for green house effect are called green house gases which trap the radiations and don't let them reflect back from the earth's surface. The green house gases are Chlorofluorocarbons (CFC's), Carbon dioxide (CO2), Methane (CH4) and Nitrous Oxide (N2O). 
The approximate percentage of different greenhouse gases in the atmosphere is:
CFCs - 14%
CO2 - 60%
‎CH4 - 20%
N2O - 6%
Hence, CO2 and CH4 have highest relative contribution to green house gases.
So, the correct answer is 'CO2 and CH4'.
Multiple choice zoology human influences on the environment carbon cycle ozone layer depletion and causes depletion of ozone layer

Gases responsible for green house effect are

  1. $CO _2$

  2. CFC
  3. $N _2O$

  4. All the above
Reveal answer Fill a bubble to check yourself
D Correct answer
Explanation

A greenhouse gas is a gas in an atmosphere that absorbs and emits radiant energy within the thermal infrared range. This process is the fundamental cause of the greenhouse effect. The primary greenhouse gases in Earth's atmosphere are water vapour, carbon dioxide, methane, CFC's, nitrous oxide, and ozone.

So the correct answer is 'All the above'.

Multiple choice zoology human influences on the environment carbon cycle ozone layer depletion and causes depletion of ozone layer

One GHG contributes $6\%$ to total global warming, other contributes to $20\%$; they are.

  1. $NO _2$ and $CO _2$
  2. $N _2O$ and CFCs

  3. CFCs and methane
  4. $N _2O$ and methane
  5. $CO _2$ and CFCs
Reveal answer Fill a bubble to check yourself
D Correct answer
Explanation
The relative contribution of various greenhouse gases to total global warming are as follows:
Methane: 20%
CFCs(Chloro-fluoro-carbons): 14%
N$ _2$O: 6%
Carbon dioxide: 60%
So, the correct answer is 'Option D- N$ _2$O and methane'.
Multiple choice zoology human influences on the environment carbon cycle ozone layer depletion and causes depletion of ozone layer

Greenhouse gases are

  1. $CO _2$ and $CH _4$
  2. $N _2O$ and CFCs

  3. Ozone

  4. All of the above
Reveal answer Fill a bubble to check yourself
D Correct answer
Explanation

Carbon dioxide and methane are naturally occurring gases. Nitrous oxides are formed due to denitrification and combustion of the fossil fuels. CFCs are used as refrigerants and propellants. Ozone is formed as a secondary pollutant. All these are greenhouse gases because they show greenhouse effect by absorbing the the long-wavelength infra-red radiations coming from the earth's surface and preventing from leaving the atmosphere. This effect is responsible for maintaining the ambient temperature on the earth. Their  amounts have increased over the past years and this has adversely affected the global temperature by raiding it. This is called global warming and is responsible for climate change. 

Hence, the correct answer is 'All of the above'

Multiple choice zoology human influences on the environment carbon cycle ozone layer depletion and causes depletion of ozone layer

Which one of the following statements is not correct?

  1. The greenhouse gases trap out the heal in infra-red radiation

  2. Natural gas supplies five percent f global energy needs
  3. One molecule of CFC can trap as many as $10,000$ molecules of $CO _2$
  4. The atmospheric life time to $CFCl _3$ is estimated at $75$ years
Reveal answer Fill a bubble to check yourself
A Correct answer
Multiple choice zoology human influences on the environment carbon cycle ozone layer depletion and causes depletion of ozone layer

Green house gases are called as such because they.

  1. Prevent the escape of heat waves reradiated from the earth's surface

  2. Are produced in greenhouses

  3. Are used in warming plant growth chambers
  4. Help in maintaining atmospheric $O _2$ and $CO _2$ balance
Reveal answer Fill a bubble to check yourself
A Correct answer
Explanation

Greenhouse gases are named for their ability to mimic the effect of a greenhouse, where glass allows sunlight in but traps the heat reradiated from the surface.

Multiple choice zoology human influences on the environment carbon cycle ozone layer depletion and causes depletion of ozone layer

Which one of the following is major given house gas?

  1. Freon
  2. $CO _2$

  3. CFC
  4. $NO _2$
Reveal answer Fill a bubble to check yourself
B Correct answer
Explanation

greenhouse gases are those gases which absorb the heat or thermal infrared radiations of the sun and is responsible for an increase in the temperature of the earth's surface .there are several greenhouse gases that are produced either naturally or is being emitted in the atmosphere by a man-made source. The most abundant or major greenhouse gas is Carbon Dioxide.

so the correct answer is 'CO2'.

Multiple choice zoology human influences on the environment carbon cycle ozone layer depletion and causes depletion of ozone layer

Multiple Choice Questions
Which one is correct percentage of green house gases

  1. Methane - $20\%$, $N _2O $- $18\%$
  2. CFCs -$14\%$, Methane - $20\%$
  3. $CO _2$ - $40\%$, CFCs -$30\%$
  4. $N _2O$ - $6\%. $ $CO _2$ - $86\%$
Reveal answer Fill a bubble to check yourself
B Correct answer
Explanation

Relative concentration of various greenhouse gases in the atmosphere is as: CO$ _2$ (60%), CH$ _4$ (20%), CFCs (14%) and N$ _2$O (6%).

So, the correct answer is CFCs-14%, Methane 20%.

Multiple choice zoology human influences on the environment carbon cycle ozone layer depletion and causes depletion of ozone layer

Which of the following gases are mainly responsible for the atmospheric greenhouse effect in the earth's atmosphere?

  1. Oxygen and nitrogen

  2. Nitrogen and carbon dioxide

  3. Ozone and oxygen

  4. Water vapor and carbon dioxide
Reveal answer Fill a bubble to check yourself
D Correct answer
Explanation

Water vapor and carbon dioxide are the most significant contributors to the greenhouse effect in the Earth's atmosphere, with water vapor being the most abundant and CO2 being the most significant anthropogenic contributor.

Multiple choice zoology human influences on the environment carbon cycle ozone layer depletion and causes depletion of ozone layer

The gas responsible for the greenhouse effect on Venus is:

  1. Carbon dioxide $(CO _{2})$
  2. Oxygen $(O _{2})$
  3. Ozone $(O _{3})$
  4. Nitrogen $(N _{2})$
Reveal answer Fill a bubble to check yourself
A Correct answer
Explanation

Venus has a thick atmosphere composed primarily of carbon dioxide, which creates an extreme greenhouse effect, resulting in surface temperatures hot enough to melt lead.